About 1-(dipropylamino)ethanol
1-(dipropylamino)ethanol (PubChem CID 18004289) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is 1-(dipropylamino)ethanol.
Molecular Properties
| Compound Name | 1-(dipropylamino)ethanol |
| PubChem CID | 18004289 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 1-(dipropylamino)ethanol |
| SMILES | CCCN(CCC)C(C)O |
| InChI | InChI=1S/C8H19NO/c1-4-6-9(7-5-2)8(3)10/h8,10H,4-7H2,1-3H3 |
| InChIKey | COKMLVOGWBEPNX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(dipropylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dipropylamino)ethanol?
The IUPAC name of 1-(dipropylamino)ethanol (CID 18004289) is 1-(dipropylamino)ethanol.
What is the SMILES notation for 1-(dipropylamino)ethanol?
The canonical SMILES for 1-(dipropylamino)ethanol is CCCN(CCC)C(C)O.
What is the InChIKey of 1-(dipropylamino)ethanol?
The InChIKey is COKMLVOGWBEPNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO/c1-4-6-9(7-5-2)8(3)10/h8,10H,4-7H2,1-3H3.
What are the key properties of 1-(dipropylamino)ethanol?
1-(dipropylamino)ethanol has a molecular weight of 145.25 g/mol, XLogP of 1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dipropylamino)ethanol is sourced from PubChem (CID 18004289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).