About 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine (PubChem CID 18004625) has the molecular formula C20H19F6NO2
and a molecular weight of 419.37 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine.
Molecular Properties
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine |
| PubChem CID | 18004625 |
| Molecular Formula | C20H19F6NO2 |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine |
| SMILES | CC1COC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(c2ccccc2)N1 |
| InChI | InChI=1S/C20H19F6NO2/c1-12-10-28-18(17(27-12)14-5-3-2-4-6-14)29-11-13-7-15(19(21,22)23)9-16(8-13)20(24,25)26/h2-9,12,17-18,27H,10-11H2,1H3 |
| InChIKey | PUZOQLKLCNWXCR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine?
The IUPAC name of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine (CID 18004625) is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine.
What is the SMILES notation for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine?
The canonical SMILES for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine is CC1COC(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(c2ccccc2)N1.
What is the InChIKey of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine?
The InChIKey is PUZOQLKLCNWXCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F6NO2/c1-12-10-28-18(17(27-12)14-5-3-2-4-6-14)29-11-13-7-15(19(21,22)23)9-16(8-13)20(24,25)26/h2-9,12,17-18,27H,10-11H2,1H3.
What are the key properties of 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine?
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine has a molecular weight of 419.37 g/mol, XLogP of 5.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-methyl-3-phenylmorpholine is sourced from PubChem (CID 18004625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).