C32H38F3N5O4S — CID 18004801
2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-[(2,2,2-trifluoroethylamino)methyl]phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide (PubChem CID 18004801) has the molecular formula C32H38F3N5O4S and a molecular weight of 645.75 g/mol. Its IUPAC name is 2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-[(2,2,2-trifluoroethylamino)methyl]phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide.
| Compound Name | 2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-[(2,2,2-trifluoroethylamino)methyl]phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 18004801 |
| Molecular Formula | C32H38F3N5O4S |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | 2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-[(2,2,2-trifluoroethylamino)methyl]phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CNCC(F)(F)F)c1 |
| InChI | InChI=1S/C32H38F3N5O4S/c1-4-5-12-28-37-31(15-8-9-16-31)30(41)40(28)19-23-13-14-25(24(17-23)18-36-20-32(33,34)35)26-10-6-7-11-27(26)45(42,43)39-29-21(2)22(3)38-44-29/h6-7,10-11,13-14,17,36,39H,4-5,8-9,12,15-16,18-20H2,1-3H3 |
| InChIKey | KKHKKNANBGSMCC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |