C10H10O4 — CID 18005850
7-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid (PubChem CID 18005850) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 7-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid.
| Compound Name | 7-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 18005850 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 7-hydroxy-3,4-dihydro-2H-chromene-2-carboxylic acid |
| SMILES | O=C(O)C1CCc2ccc(O)cc2O1 |
| InChI | InChI=1S/C10H10O4/c11-7-3-1-6-2-4-8(10(12)13)14-9(6)5-7/h1,3,5,8,11H,2,4H2,(H,12,13) |
| InChIKey | NONJZGQBLPTNTD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |