About 6-phenylmethoxy-2,3-dihydro-1-benzofuran
6-phenylmethoxy-2,3-dihydro-1-benzofuran (PubChem CID 18005853) has the molecular formula C15H14O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is 6-phenylmethoxy-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 6-phenylmethoxy-2,3-dihydro-1-benzofuran |
| PubChem CID | 18005853 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 6-phenylmethoxy-2,3-dihydro-1-benzofuran |
| SMILES | c1ccc(COc2ccc3c(c2)OCC3)cc1 |
| InChI | InChI=1S/C15H14O2/c1-2-4-12(5-3-1)11-17-14-7-6-13-8-9-16-15(13)10-14/h1-7,10H,8-9,11H2 |
| InChIKey | LIGUHHPSWRMXSB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-phenylmethoxy-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylmethoxy-2,3-dihydro-1-benzofuran?
The IUPAC name of 6-phenylmethoxy-2,3-dihydro-1-benzofuran (CID 18005853) is 6-phenylmethoxy-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 6-phenylmethoxy-2,3-dihydro-1-benzofuran?
The canonical SMILES for 6-phenylmethoxy-2,3-dihydro-1-benzofuran is c1ccc(COc2ccc3c(c2)OCC3)cc1.
What is the InChIKey of 6-phenylmethoxy-2,3-dihydro-1-benzofuran?
The InChIKey is LIGUHHPSWRMXSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2/c1-2-4-12(5-3-1)11-17-14-7-6-13-8-9-16-15(13)10-14/h1-7,10H,8-9,11H2.
What are the key properties of 6-phenylmethoxy-2,3-dihydro-1-benzofuran?
6-phenylmethoxy-2,3-dihydro-1-benzofuran has a molecular weight of 226.28 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylmethoxy-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 18005853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).