About (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol
(2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol (PubChem CID 18005860) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol.
Molecular Properties
| Compound Name | (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol |
| PubChem CID | 18005860 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol |
| SMILES | OCC1(OCc2ccccc2)CCc2ccccc2O1 |
| InChI | InChI=1S/C17H18O3/c18-13-17(19-12-14-6-2-1-3-7-14)11-10-15-8-4-5-9-16(15)20-17/h1-9,18H,10-13H2 |
| InChIKey | SFAPPLVFSBNUAX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol?
The IUPAC name of (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol (CID 18005860) is (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol.
What is the SMILES notation for (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol?
The canonical SMILES for (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol is OCC1(OCc2ccccc2)CCc2ccccc2O1.
What is the InChIKey of (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol?
The InChIKey is SFAPPLVFSBNUAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O3/c18-13-17(19-12-14-6-2-1-3-7-14)11-10-15-8-4-5-9-16(15)20-17/h1-9,18H,10-13H2.
What are the key properties of (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol?
(2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol has a molecular weight of 270.33 g/mol, XLogP of 2.92, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylmethoxy-3,4-dihydrochromen-2-yl)methanol is sourced from PubChem (CID 18005860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).