About 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide
2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide (PubChem CID 18005905) has the molecular formula C10H19N3O2
and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide.
Molecular Properties
| Compound Name | 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide |
| PubChem CID | 18005905 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide |
| SMILES | C=C(C)C(N)=O.C=C(CN(C)C)C(N)=O |
| InChI | InChI=1S/C6H12N2O.C4H7NO/c1-5(6(7)9)4-8(2)3;1-3(2)4(5)6/h1,4H2,2-3H3,(H2,7,9);1H2,2H3,(H2,5,6) |
| InChIKey | BUYQQTMKMNVARY-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide?
The IUPAC name of 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide (CID 18005905) is 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide.
What is the SMILES notation for 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide?
The canonical SMILES for 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide is C=C(C)C(N)=O.C=C(CN(C)C)C(N)=O.
What is the InChIKey of 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide?
The InChIKey is BUYQQTMKMNVARY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C4H7NO/c1-5(6(7)9)4-8(2)3;1-3(2)4(5)6/h1,4H2,2-3H3,(H2,7,9);1H2,2H3,(H2,5,6).
What are the key properties of 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide?
2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide has a molecular weight of 213.28 g/mol, XLogP of -0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(dimethylamino)methyl]prop-2-enamide;2-methylprop-2-enamide is sourced from PubChem (CID 18005905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).