About N-ethyl-1,3-thiazole-2-carboxamide
N-ethyl-1,3-thiazole-2-carboxamide (PubChem CID 18006162) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is N-ethyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 18006162 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | N-ethyl-1,3-thiazole-2-carboxamide |
| SMILES | CCNC(=O)c1nccs1 |
| InChI | InChI=1S/C6H8N2OS/c1-2-7-5(9)6-8-3-4-10-6/h3-4H,2H2,1H3,(H,7,9) |
| InChIKey | BBHZJZKBZVPDFZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,3-thiazole-2-carboxamide?
The IUPAC name of N-ethyl-1,3-thiazole-2-carboxamide (CID 18006162) is N-ethyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-ethyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-ethyl-1,3-thiazole-2-carboxamide is CCNC(=O)c1nccs1.
What is the InChIKey of N-ethyl-1,3-thiazole-2-carboxamide?
The InChIKey is BBHZJZKBZVPDFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c1-2-7-5(9)6-8-3-4-10-6/h3-4H,2H2,1H3,(H,7,9).
What are the key properties of N-ethyl-1,3-thiazole-2-carboxamide?
N-ethyl-1,3-thiazole-2-carboxamide has a molecular weight of 156.21 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 18006162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).