C16H21BF3NO3 — CID 18006346
2,2,2-trifluoro-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]acetamide (PubChem CID 18006346) has the molecular formula C16H21BF3NO3 and a molecular weight of 343.15 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 18006346 |
| Molecular Formula | C16H21BF3NO3 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]acetamide |
| SMILES | CC1(C)OB(c2ccc(CCNC(=O)C(F)(F)F)cc2)OC1(C)C |
| InChI | InChI=1S/C16H21BF3NO3/c1-14(2)15(3,4)24-17(23-14)12-7-5-11(6-8-12)9-10-21-13(22)16(18,19)20/h5-8H,9-10H2,1-4H3,(H,21,22) |
| InChIKey | NHOIGXPHOQDQNE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|