C19H12F7NO4S — CID 18006407
2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-4-methylsulfonylisoindole-1,3-dione (PubChem CID 18006407) has the molecular formula C19H12F7NO4S and a molecular weight of 483.36 g/mol. Its IUPAC name is 2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-4-methylsulfonylisoindole-1,3-dione.
| Compound Name | 2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-4-methylsulfonylisoindole-1,3-dione |
|---|---|
| PubChem CID | 18006407 |
| Molecular Formula | C19H12F7NO4S |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-4-methylsulfonylisoindole-1,3-dione |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1N1C(=O)c2cccc(S(C)(=O)=O)c2C1=O |
| InChI | InChI=1S/C19H12F7NO4S/c1-9-8-10(17(20,18(21,22)23)19(24,25)26)6-7-12(9)27-15(28)11-4-3-5-13(32(2,30)31)14(11)16(27)29/h3-8H,1-2H3 |
| InChIKey | ALOHHMBJEIQFDX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|