C21H21ClO6S2 — CID 18007040
4-chlorobenzenesulfonic acid;2-(2,4,6-trimethylphenyl)benzenesulfonic acid (PubChem CID 18007040) has the molecular formula C21H21ClO6S2 and a molecular weight of 468.98 g/mol. Its IUPAC name is 4-chlorobenzenesulfonic acid;2-(2,4,6-trimethylphenyl)benzenesulfonic acid.
| Compound Name | 4-chlorobenzenesulfonic acid;2-(2,4,6-trimethylphenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 18007040 |
| Molecular Formula | C21H21ClO6S2 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 4-chlorobenzenesulfonic acid;2-(2,4,6-trimethylphenyl)benzenesulfonic acid |
| SMILES | Cc1cc(C)c(-c2ccccc2S(=O)(=O)O)c(C)c1.O=S(=O)(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16O3S.C6H5ClO3S/c1-10-8-11(2)15(12(3)9-10)13-6-4-5-7-14(13)19(16,17)18;7-5-1-3-6(4-2-5)11(8,9)10/h4-9H,1-3H3,(H,16,17,18);1-4H,(H,8,9,10) |
| InChIKey | APJKBEFIZDCYLD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|