C24H28F3NO5S — CID 18007307
[6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl] trifluoromethanesulfonate (PubChem CID 18007307) has the molecular formula C24H28F3NO5S and a molecular weight of 499.55 g/mol. Its IUPAC name is [6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl] trifluoromethanesulfonate.
| Compound Name | [6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18007307 |
| Molecular Formula | C24H28F3NO5S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | [6-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)C1CCCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C24H28F3NO5S/c1-23(2,3)32-22(29)28(16-17-8-5-4-6-9-17)20-11-7-10-18-12-13-21(15-19(18)14-20)33-34(30,31)24(25,26)27/h4-6,8-9,12-13,15,20H,7,10-11,14,16H2,1-3H3 |
| InChIKey | CUUMTLKBPXTTFM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|