C15H16F3NO — CID 18007811
2,2,2-trifluoro-N-[4-methyl-3,5-bis(prop-2-enyl)phenyl]acetamide (PubChem CID 18007811) has the molecular formula C15H16F3NO and a molecular weight of 283.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-methyl-3,5-bis(prop-2-enyl)phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-methyl-3,5-bis(prop-2-enyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18007811 |
| Molecular Formula | C15H16F3NO |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-methyl-3,5-bis(prop-2-enyl)phenyl]acetamide |
| SMILES | C=CCc1cc(NC(=O)C(F)(F)F)cc(CC=C)c1C |
| InChI | InChI=1S/C15H16F3NO/c1-4-6-11-8-13(19-14(20)15(16,17)18)9-12(7-5-2)10(11)3/h4-5,8-9H,1-2,6-7H2,3H3,(H,19,20) |
| InChIKey | UODWQHCACBZGFG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|