C12H16N4 — CID 18008429
4-(2-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 18008429) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 4-(2-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-(2-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 18008429 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 4-(2-methylpiperidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | CC1CCCCN1c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C12H16N4/c1-9-4-2-3-7-16(9)12-10-5-6-13-11(10)14-8-15-12/h5-6,8-9H,2-4,7H2,1H3,(H,13,14,15) |
| InChIKey | TUDFWDRQFZNJSM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |