C19H28 — CID 18008539
1,2,3,5-tetramethyl-5-[(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)methyl]cyclopenta-1,3-diene (PubChem CID 18008539) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 1,2,3,5-tetramethyl-5-[(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)methyl]cyclopenta-1,3-diene.
| Compound Name | 1,2,3,5-tetramethyl-5-[(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)methyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 18008539 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1,2,3,5-tetramethyl-5-[(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)methyl]cyclopenta-1,3-diene |
| SMILES | CC1=CC(C)(CC2(C)C=C(C)C(C)=C2C)C(C)=C1C |
| InChI | InChI=1S/C19H28/c1-12-9-18(7,16(5)14(12)3)11-19(8)10-13(2)15(4)17(19)6/h9-10H,11H2,1-8H3 |
| InChIKey | FSBJUWIZMBJJIB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |