C26H32N4O5S — CID 18008552
10,10-dioxo-1-N,9-N-bis(2-pyrrolidin-1-ylethyl)phenoxathiine-1,9-dicarboxamide (PubChem CID 18008552) has the molecular formula C26H32N4O5S and a molecular weight of 512.63 g/mol. Its IUPAC name is 10,10-dioxo-1-N,9-N-bis(2-pyrrolidin-1-ylethyl)phenoxathiine-1,9-dicarboxamide.
| Compound Name | 10,10-dioxo-1-N,9-N-bis(2-pyrrolidin-1-ylethyl)phenoxathiine-1,9-dicarboxamide |
|---|---|
| PubChem CID | 18008552 |
| Molecular Formula | C26H32N4O5S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 10,10-dioxo-1-N,9-N-bis(2-pyrrolidin-1-ylethyl)phenoxathiine-1,9-dicarboxamide |
| SMILES | O=C(NCCN1CCCC1)c1cccc2c1S(=O)(=O)c1c(cccc1C(=O)NCCN1CCCC1)O2 |
| InChI | InChI=1S/C26H32N4O5S/c31-25(27-11-17-29-13-1-2-14-29)19-7-5-9-21-23(19)36(33,34)24-20(8-6-10-22(24)35-21)26(32)28-12-18-30-15-3-4-16-30/h5-10H,1-4,11-18H2,(H,27,31)(H,28,32) |
| InChIKey | MWXBLVXRRJACJG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |