About 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate
2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate (PubChem CID 18008733) has the molecular formula C20H30O3
and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate.
Molecular Properties
| Compound Name | 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate |
| PubChem CID | 18008733 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate |
| SMILES | CC(C)(OC(=O)C1CC2C3C=CC(C3)C2C1)C1CCC(O)CC1 |
| InChI | InChI=1S/C20H30O3/c1-20(2,15-5-7-16(21)8-6-15)23-19(22)14-10-17-12-3-4-13(9-12)18(17)11-14/h3-4,12-18,21H,5-11H2,1-2H3 |
| InChIKey | RYWGQBBDMFPVQA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate?
The IUPAC name of 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate (CID 18008733) is 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate.
What is the SMILES notation for 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate?
The canonical SMILES for 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate is CC(C)(OC(=O)C1CC2C3C=CC(C3)C2C1)C1CCC(O)CC1.
What is the InChIKey of 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate?
The InChIKey is RYWGQBBDMFPVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O3/c1-20(2,15-5-7-16(21)8-6-15)23-19(22)14-10-17-12-3-4-13(9-12)18(17)11-14/h3-4,12-18,21H,5-11H2,1-2H3.
What are the key properties of 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate?
2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate has a molecular weight of 318.46 g/mol, XLogP of 3.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxycyclohexyl)propan-2-yl tricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate is sourced from PubChem (CID 18008733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).