C17H30O — CID 18008828
1,1,2,3,3-pentamethyl-5-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-2H-inden-4-ol (PubChem CID 18008828) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 1,1,2,3,3-pentamethyl-5-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-2H-inden-4-ol.
| Compound Name | 1,1,2,3,3-pentamethyl-5-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-2H-inden-4-ol |
|---|---|
| PubChem CID | 18008828 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 1,1,2,3,3-pentamethyl-5-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-2H-inden-4-ol |
| SMILES | C=CCC1CCC2C(C1O)C(C)(C)C(C)C2(C)C |
| InChI | InChI=1S/C17H30O/c1-7-8-12-9-10-13-14(15(12)18)17(5,6)11(2)16(13,3)4/h7,11-15,18H,1,8-10H2,2-6H3 |
| InChIKey | XNGMPTNJRRSETR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|