C5H7F2NO — CID 18008834
4,4-difluoropyrrolidine-2-carbaldehyde (PubChem CID 18008834) has the molecular formula C5H7F2NO and a molecular weight of 135.11 g/mol. Its IUPAC name is 4,4-difluoropyrrolidine-2-carbaldehyde.
| Compound Name | 4,4-difluoropyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 18008834 |
| Molecular Formula | C5H7F2NO |
| Molecular Weight | 135.11 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 4,4-difluoropyrrolidine-2-carbaldehyde |
| SMILES | O=CC1CC(F)(F)CN1 |
| InChI | InChI=1S/C5H7F2NO/c6-5(7)1-4(2-9)8-3-5/h2,4,8H,1,3H2 |
| InChIKey | QMVXXBYNRQSGCK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.11 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|