About 7-bromo-3,4-dihydro-2H-1,4-benzoxazine
7-bromo-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 18008960) has the molecular formula C8H8BrNO
and a molecular weight of 214.06 g/mol. Its IUPAC name is 7-bromo-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 7-bromo-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 18008960 |
| Molecular Formula | C8H8BrNO |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 212.98 |
| IUPAC Name | 7-bromo-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Brc1ccc2c(c1)OCCN2 |
| InChI | InChI=1S/C8H8BrNO/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5,10H,3-4H2 |
| InChIKey | JLZUUGCTPRPFKZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 7-bromo-3,4-dihydro-2H-1,4-benzoxazine (CID 18008960) is 7-bromo-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 7-bromo-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 7-bromo-3,4-dihydro-2H-1,4-benzoxazine is Brc1ccc2c(c1)OCCN2.
What is the InChIKey of 7-bromo-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is JLZUUGCTPRPFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5,10H,3-4H2.
What are the key properties of 7-bromo-3,4-dihydro-2H-1,4-benzoxazine?
7-bromo-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 214.06 g/mol, XLogP of 2.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 18008960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).