C21H20ClF3N4O — CID 18009126
4-[[6-[2-chloro-5-methyl-N-(4,4,4-trifluorobutyl)anilino]pyrimidin-4-yl]amino]phenol (PubChem CID 18009126) has the molecular formula C21H20ClF3N4O and a molecular weight of 436.87 g/mol. Its IUPAC name is 4-[[6-[2-chloro-5-methyl-N-(4,4,4-trifluorobutyl)anilino]pyrimidin-4-yl]amino]phenol.
| Compound Name | 4-[[6-[2-chloro-5-methyl-N-(4,4,4-trifluorobutyl)anilino]pyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 18009126 |
| Molecular Formula | C21H20ClF3N4O |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 4-[[6-[2-chloro-5-methyl-N-(4,4,4-trifluorobutyl)anilino]pyrimidin-4-yl]amino]phenol |
| SMILES | Cc1ccc(Cl)c(N(CCCC(F)(F)F)c2cc(Nc3ccc(O)cc3)ncn2)c1 |
| InChI | InChI=1S/C21H20ClF3N4O/c1-14-3-8-17(22)18(11-14)29(10-2-9-21(23,24)25)20-12-19(26-13-27-20)28-15-4-6-16(30)7-5-15/h3-8,11-13,30H,2,9-10H2,1H3,(H,26,27,28) |
| InChIKey | PRTFIAHIPYHTAJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|