C6H8F3NO3S — CID 18009259
1,2,3,6-tetrahydropyridin-4-yl trifluoromethanesulfonate (PubChem CID 18009259) has the molecular formula C6H8F3NO3S and a molecular weight of 231.19 g/mol. Its IUPAC name is 1,2,3,6-tetrahydropyridin-4-yl trifluoromethanesulfonate.
| Compound Name | 1,2,3,6-tetrahydropyridin-4-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18009259 |
| Molecular Formula | C6H8F3NO3S |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 1,2,3,6-tetrahydropyridin-4-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C6H8F3NO3S/c7-6(8,9)14(11,12)13-5-1-3-10-4-2-5/h1,10H,2-4H2 |
| InChIKey | HNXZSRFTSWZMAG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|