About [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate
[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate (PubChem CID 18009461) has the molecular formula C26H34N2O4
and a molecular weight of 438.57 g/mol. Its IUPAC name is [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate.
Molecular Properties
| Compound Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate |
| PubChem CID | 18009461 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate |
| SMILES | CCCCNC(=O)OC1CCC(CNC(=O)c2ccccc2OC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H34N2O4/c1-3-4-18-27-25(30)32-21-14-16-26(17-15-21,20-10-6-5-7-11-20)19-28-24(29)22-12-8-9-13-23(22)31-2/h5-13,21H,3-4,14-19H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | QGWCCQLWCCPQHO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate?
The IUPAC name of [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate (CID 18009461) is [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate.
What is the SMILES notation for [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate?
The canonical SMILES for [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate is CCCCNC(=O)OC1CCC(CNC(=O)c2ccccc2OC)(c2ccccc2)CC1.
What is the InChIKey of [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate?
The InChIKey is QGWCCQLWCCPQHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34N2O4/c1-3-4-18-27-25(30)32-21-14-16-26(17-15-21,20-10-6-5-7-11-20)19-28-24(29)22-12-8-9-13-23(22)31-2/h5-13,21H,3-4,14-19H2,1-2H3,(H,27,30)(H,28,29).
What are the key properties of [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate?
[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate has a molecular weight of 438.57 g/mol, XLogP of 4.83, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-butylcarbamate is sourced from PubChem (CID 18009461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).