C23H33N3O4 — CID 18009956
tert-butyl N-[1-[ethynyl-[2-oxo-2-(pentan-2-ylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 18009956) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is tert-butyl N-[1-[ethynyl-[2-oxo-2-(pentan-2-ylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[ethynyl-[2-oxo-2-(pentan-2-ylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18009956 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | tert-butyl N-[1-[ethynyl-[2-oxo-2-(pentan-2-ylamino)-1-phenylethyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)NC(C)CCC)c1ccccc1 |
| InChI | InChI=1S/C23H33N3O4/c1-8-13-16(3)24-20(27)19(18-14-11-10-12-15-18)26(9-2)21(28)17(4)25-22(29)30-23(5,6)7/h2,10-12,14-17,19H,8,13H2,1,3-7H3,(H,24,27)(H,25,29) |
| InChIKey | CIILLSRAYRBRCO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|