C32H47N3O5 — CID 18015074
tert-butyl N-[1-[[2-(benzylamino)-1-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-octylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18015074) has the molecular formula C32H47N3O5 and a molecular weight of 553.74 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(benzylamino)-1-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-octylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(benzylamino)-1-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-octylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18015074 |
| Molecular Formula | C32H47N3O5 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | tert-butyl N-[1-[[2-(benzylamino)-1-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-octylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)NCc1ccccc1)c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C32H47N3O5/c1-7-8-9-10-11-15-20-35(30(38)24(3)34-31(39)40-32(4,5)6)28(26-18-19-27(36)23(2)21-26)29(37)33-22-25-16-13-12-14-17-25/h12-14,16-19,21,24,28,36H,7-11,15,20,22H2,1-6H3,(H,33,37)(H,34,39) |
| InChIKey | LDRITAFYWQJUFS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|