C28H47N3O4 — CID 18020723
tert-butyl N-[2-[[1-(3,4-dimethylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-2-oxoethyl]carbamate (PubChem CID 18020723) has the molecular formula C28H47N3O4 and a molecular weight of 489.70 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(3,4-dimethylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(3,4-dimethylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18020723 |
| Molecular Formula | C28H47N3O4 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.36 |
| IUPAC Name | tert-butyl N-[2-[[1-(3,4-dimethylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]-octylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)NC(C)C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C28H47N3O4/c1-9-10-11-12-13-14-17-31(24(32)19-29-27(34)35-28(6,7)8)25(26(33)30-20(2)3)23-16-15-21(4)22(5)18-23/h15-16,18,20,25H,9-14,17,19H2,1-8H3,(H,29,34)(H,30,33) |
| InChIKey | BPVZEVUMCSCTIL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|