About 4-phenylbenzonitrile
4-phenylbenzonitrile (PubChem CID 18021) has the molecular formula C13H9N
and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-phenylbenzonitrile.
Molecular Properties
| Compound Name | 4-phenylbenzonitrile |
| PubChem CID | 18021 |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 4-phenylbenzonitrile |
| SMILES | N#Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H9N/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H |
| InChIKey | BPMBNLJJRKCCRT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbenzonitrile?
The IUPAC name of 4-phenylbenzonitrile (CID 18021) is 4-phenylbenzonitrile.
What is the SMILES notation for 4-phenylbenzonitrile?
The canonical SMILES for 4-phenylbenzonitrile is N#Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 4-phenylbenzonitrile?
The InChIKey is BPMBNLJJRKCCRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H.
What are the key properties of 4-phenylbenzonitrile?
4-phenylbenzonitrile has a molecular weight of 179.22 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbenzonitrile is sourced from PubChem (CID 18021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).