C30H38ClN3O4 — CID 18021587
tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(3,4-dimethylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18021587) has the molecular formula C30H38ClN3O4 and a molecular weight of 540.10 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(3,4-dimethylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(3,4-dimethylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18021587 |
| Molecular Formula | C30H38ClN3O4 |
| Molecular Weight | 540.10 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(3,4-dimethylphenyl)-2-oxoethyl]-ethynylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(NC(=O)OC(C)(C)C)C(C)CC)C(C(=O)Nc1c(C)cccc1Cl)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C30H38ClN3O4/c1-10-18(3)25(33-29(37)38-30(7,8)9)28(36)34(11-2)26(22-16-15-19(4)21(6)17-22)27(35)32-24-20(5)13-12-14-23(24)31/h2,12-18,25-26H,10H2,1,3-9H3,(H,32,35)(H,33,37) |
| InChIKey | NDNUYJJHLAHGDL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.10 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|