About 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol
2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol (PubChem CID 18026) has the molecular formula C15H25NO3
and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol.
Molecular Properties
| Compound Name | 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol |
| PubChem CID | 18026 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(OC)c(C(O)C(C)NC(C)(C)C)c1 |
| InChI | InChI=1S/C15H25NO3/c1-10(16-15(2,3)4)14(17)12-9-11(18-5)7-8-13(12)19-6/h7-10,14,16-17H,1-6H3 |
| InChIKey | TWUSDDMONZULSC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol?
The IUPAC name of 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol (CID 18026) is 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol.
What is the SMILES notation for 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol?
The canonical SMILES for 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol is COc1ccc(OC)c(C(O)C(C)NC(C)(C)C)c1.
What is the InChIKey of 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol?
The InChIKey is TWUSDDMONZULSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO3/c1-10(16-15(2,3)4)14(17)12-9-11(18-5)7-8-13(12)19-6/h7-10,14,16-17H,1-6H3.
What are the key properties of 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol?
2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol has a molecular weight of 267.37 g/mol, XLogP of 2.51, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol is sourced from PubChem (CID 18026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).