C28H35N3O6S — CID 18027244
tert-butyl N-[1-[ethynyl-[1-(2-hydroxy-3-methylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18027244) has the molecular formula C28H35N3O6S and a molecular weight of 541.67 g/mol. Its IUPAC name is tert-butyl N-[1-[ethynyl-[1-(2-hydroxy-3-methylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[ethynyl-[1-(2-hydroxy-3-methylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18027244 |
| Molecular Formula | C28H35N3O6S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | tert-butyl N-[1-[ethynyl-[1-(2-hydroxy-3-methylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(CCSC)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1cccc(C)c1O |
| InChI | InChI=1S/C28H35N3O6S/c1-8-31(26(34)22(16-17-38-7)30-27(35)37-28(3,4)5)23(21-11-9-10-18(2)24(21)32)25(33)29-19-12-14-20(36-6)15-13-19/h1,9-15,22-23,32H,16-17H2,2-7H3,(H,29,33)(H,30,35) |
| InChIKey | WEQSXGZIJVIIBP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|