C34H51N3O4S — CID 18031949
tert-butyl N-[1-[[2-(benzylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18031949) has the molecular formula C34H51N3O4S and a molecular weight of 597.87 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(benzylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(benzylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18031949 |
| Molecular Formula | C34H51N3O4S |
| Molecular Weight | 597.87 g/mol |
| Exact Mass | 597.36 |
| IUPAC Name | tert-butyl N-[1-[[2-(benzylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CCSC)NC(=O)OC(C)(C)C)C(C(=O)NCc1ccccc1)c1cccc(C)c1 |
| InChI | InChI=1S/C34H51N3O4S/c1-7-8-9-10-11-15-22-37(32(39)29(21-23-42-6)36-33(40)41-34(3,4)5)30(28-20-16-17-26(2)24-28)31(38)35-25-27-18-13-12-14-19-27/h12-14,16-20,24,29-30H,7-11,15,21-23,25H2,1-6H3,(H,35,38)(H,36,40) |
| InChIKey | GUCPKUDNGJBGGQ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.87 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|