C26H40N4O4 — CID 18038950
tert-butyl N-[1-[[2-(butylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 18038950) has the molecular formula C26H40N4O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18038950 |
| Molecular Formula | C26H40N4O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1cccc(C)c1C)N(CC#N)C(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C26H40N4O4/c1-9-10-15-28-23(31)22(20-13-11-12-18(4)19(20)5)30(16-14-27)24(32)21(17(2)3)29-25(33)34-26(6,7)8/h11-13,17,21-22H,9-10,15-16H2,1-8H3,(H,28,31)(H,29,33) |
| InChIKey | HTZZCOMJWDEUCK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|