C29H37N3O5 — CID 18044340
tert-butyl N-[1-[ethynyl-[1-(2-hydroxy-3-methylphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18044340) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is tert-butyl N-[1-[ethynyl-[1-(2-hydroxy-3-methylphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[ethynyl-[1-(2-hydroxy-3-methylphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18044340 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | tert-butyl N-[1-[ethynyl-[1-(2-hydroxy-3-methylphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1cccc(C)c1O |
| InChI | InChI=1S/C29H37N3O5/c1-9-32(27(35)23(17-18(2)3)31-28(36)37-29(6,7)8)24(21-15-12-14-20(5)25(21)33)26(34)30-22-16-11-10-13-19(22)4/h1,10-16,18,23-24,33H,17H2,2-8H3,(H,30,34)(H,31,36) |
| InChIKey | ZVUAYYVXSIKYCL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|