C31H44ClN3O4 — CID 18047582
tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-2-oxo-1-phenylethyl]-pentylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18047582) has the molecular formula C31H44ClN3O4 and a molecular weight of 558.16 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-2-oxo-1-phenylethyl]-pentylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-2-oxo-1-phenylethyl]-pentylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18047582 |
| Molecular Formula | C31H44ClN3O4 |
| Molecular Weight | 558.16 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-2-oxo-1-phenylethyl]-pentylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C31H44ClN3O4/c1-8-9-13-19-35(29(37)25(20-21(2)3)33-30(38)39-31(5,6)7)27(23-16-11-10-12-17-23)28(36)34-26-22(4)15-14-18-24(26)32/h10-12,14-18,21,25,27H,8-9,13,19-20H2,1-7H3,(H,33,38)(H,34,36) |
| InChIKey | HKEYVYMUTKHGKS-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.16 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|