C34H59N3O4 — CID 18049152
tert-butyl N-[1-[[1-(4-ethylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18049152) has the molecular formula C34H59N3O4 and a molecular weight of 573.86 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(4-ethylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(4-ethylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18049152 |
| Molecular Formula | C34H59N3O4 |
| Molecular Weight | 573.86 g/mol |
| Exact Mass | 573.45 |
| IUPAC Name | tert-butyl N-[1-[[1-(4-ethylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1ccc(CC)cc1 |
| InChI | InChI=1S/C34H59N3O4/c1-9-12-14-15-16-18-24-37(32(39)29(25-26(4)5)36-33(40)41-34(6,7)8)30(31(38)35-23-17-13-10-2)28-21-19-27(11-3)20-22-28/h19-22,26,29-30H,9-18,23-25H2,1-8H3,(H,35,38)(H,36,40) |
| InChIKey | DEKQPVQOHPODGK-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.86 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|