C27H40N4O6 — CID 18050608
tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-prop-2-enylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18050608) has the molecular formula C27H40N4O6 and a molecular weight of 516.64 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-prop-2-enylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-prop-2-enylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18050608 |
| Molecular Formula | C27H40N4O6 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-prop-2-enylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | C=CCN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1cccc(C)c1O |
| InChI | InChI=1S/C27H40N4O6/c1-6-15-31(25(35)20(16-21(28)32)30-26(36)37-27(3,4)5)22(19-14-10-11-17(2)23(19)33)24(34)29-18-12-8-7-9-13-18/h6,10-11,14,18,20,22,33H,1,7-9,12-13,15-16H2,2-5H3,(H2,28,32)(H,29,34)(H,30,36) |
| InChIKey | ZRPZOFLNNIXBQU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|