C28H36N4O4S — CID 18055998
tert-butyl N-[1-[cyanomethyl-[2-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18055998) has the molecular formula C28H36N4O4S and a molecular weight of 524.69 g/mol. Its IUPAC name is tert-butyl N-[1-[cyanomethyl-[2-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyanomethyl-[2-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18055998 |
| Molecular Formula | C28H36N4O4S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | tert-butyl N-[1-[cyanomethyl-[2-(2,6-dimethylanilino)-1-(4-ethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCc1ccc(C(C(=O)Nc2c(C)cccc2C)N(CC#N)C(=O)C(CS)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H36N4O4S/c1-7-20-11-13-21(14-12-20)24(25(33)31-23-18(2)9-8-10-19(23)3)32(16-15-29)26(34)22(17-37)30-27(35)36-28(4,5)6/h8-14,22,24,37H,7,16-17H2,1-6H3,(H,30,35)(H,31,33) |
| InChIKey | RGRRKPBUNTUGNQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|