C31H37N3O4S — CID 18056296
tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-prop-2-enylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18056296) has the molecular formula C31H37N3O4S and a molecular weight of 547.72 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-prop-2-enylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-prop-2-enylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18056296 |
| Molecular Formula | C31H37N3O4S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-prop-2-enylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C=CCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C31H37N3O4S/c1-7-14-34(29(36)26(19-39)33-30(37)38-31(4,5)6)27(24-16-20(2)15-21(3)17-24)28(35)32-25-13-12-22-10-8-9-11-23(22)18-25/h7-13,15-18,26-27,39H,1,14,19H2,2-6H3,(H,32,35)(H,33,37) |
| InChIKey | VXAUMFUWTBAFKU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|