C24H37N3O5S — CID 18056590
tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-cyclopropylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18056590) has the molecular formula C24H37N3O5S and a molecular weight of 479.64 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-cyclopropylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-cyclopropylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18056590 |
| Molecular Formula | C24H37N3O5S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-cyclopropylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1cccc(C)c1O)N(C(=O)C(CS)NC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C24H37N3O5S/c1-6-7-13-25-21(29)19(17-10-8-9-15(2)20(17)28)27(16-11-12-16)22(30)18(14-33)26-23(31)32-24(3,4)5/h8-10,16,18-19,28,33H,6-7,11-14H2,1-5H3,(H,25,29)(H,26,31) |
| InChIKey | URJAGUNEKIVGFW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|