C29H35N3O4S — CID 18057959
tert-butyl N-[1-[[2-(benzylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-(2-methylcyclopropyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18057959) has the molecular formula C29H35N3O4S and a molecular weight of 521.68 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(benzylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-(2-methylcyclopropyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(benzylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-(2-methylcyclopropyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18057959 |
| Molecular Formula | C29H35N3O4S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | tert-butyl N-[1-[[2-(benzylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-(2-methylcyclopropyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NCc1ccccc1)N(C(=O)C(CS)NC(=O)OC(C)(C)C)C1CC1C |
| InChI | InChI=1S/C29H35N3O4S/c1-6-21-14-10-11-15-22(21)25(26(33)30-17-20-12-8-7-9-13-20)32(24-16-19(24)2)27(34)23(18-37)31-28(35)36-29(3,4)5/h1,7-15,19,23-25,37H,16-18H2,2-5H3,(H,30,33)(H,31,35) |
| InChIKey | CDRKLZWUTUNZKX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|