C24H39N3O5S — CID 18058134
tert-butyl N-[1-[tert-butyl-[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18058134) has the molecular formula C24H39N3O5S and a molecular weight of 481.66 g/mol. Its IUPAC name is tert-butyl N-[1-[tert-butyl-[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[tert-butyl-[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18058134 |
| Molecular Formula | C24H39N3O5S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | tert-butyl N-[1-[tert-butyl-[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)NC(=O)C(c1ccccc1O)N(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H39N3O5S/c1-22(2,3)26-19(29)18(15-12-10-11-13-17(15)28)27(23(4,5)6)20(30)16(14-33)25-21(31)32-24(7,8)9/h10-13,16,18,28,33H,14H2,1-9H3,(H,25,31)(H,26,29) |
| InChIKey | IJQUTKOMFCBKOW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|