C25H41N3O5S — CID 18058869
tert-butyl N-[1-[butan-2-yl-[2-(tert-butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18058869) has the molecular formula C25H41N3O5S and a molecular weight of 495.69 g/mol. Its IUPAC name is tert-butyl N-[1-[butan-2-yl-[2-(tert-butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[butan-2-yl-[2-(tert-butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18058869 |
| Molecular Formula | C25H41N3O5S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | tert-butyl N-[1-[butan-2-yl-[2-(tert-butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCC(C)N(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NC(C)(C)C)c1cccc(C)c1O |
| InChI | InChI=1S/C25H41N3O5S/c1-10-16(3)28(22(31)18(14-34)26-23(32)33-25(7,8)9)19(21(30)27-24(4,5)6)17-13-11-12-15(2)20(17)29/h11-13,16,18-19,29,34H,10,14H2,1-9H3,(H,26,32)(H,27,30) |
| InChIKey | BATYWYBKDOBVSW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|