C33H43N3O4S — CID 18059176
tert-butyl N-[1-[[1-(2,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18059176) has the molecular formula C33H43N3O4S and a molecular weight of 577.79 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18059176 |
| Molecular Formula | C33H43N3O4S |
| Molecular Weight | 577.79 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | tert-butyl N-[1-[[1-(2,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1ccc(C)cc1C |
| InChI | InChI=1S/C33H43N3O4S/c1-7-8-11-18-36(31(38)28(21-41)35-32(39)40-33(4,5)6)29(27-17-14-22(2)19-23(27)3)30(37)34-26-16-15-24-12-9-10-13-25(24)20-26/h9-10,12-17,19-20,28-29,41H,7-8,11,18,21H2,1-6H3,(H,34,37)(H,35,39) |
| InChIKey | PYKAYFFLTCGMCN-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.79 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|