C32H43N3O5S — CID 18059959
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-(5-methylhexan-2-yl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18059959) has the molecular formula C32H43N3O5S and a molecular weight of 581.78 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-(5-methylhexan-2-yl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-(5-methylhexan-2-yl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18059959 |
| Molecular Formula | C32H43N3O5S |
| Molecular Weight | 581.78 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-(5-methylhexan-2-yl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1ccc(OC)cc1)N(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C)CCC(C)C |
| InChI | InChI=1S/C32H43N3O5S/c1-9-23-12-10-11-13-26(23)28(29(36)33-24-16-18-25(39-8)19-17-24)35(22(4)15-14-21(2)3)30(37)27(20-41)34-31(38)40-32(5,6)7/h1,10-13,16-19,21-22,27-28,41H,14-15,20H2,2-8H3,(H,33,36)(H,34,38) |
| InChIKey | LUKYEWNFTWTBBG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.78 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|