C32H47N3O5S — CID 18060393
tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18060393) has the molecular formula C32H47N3O5S and a molecular weight of 585.81 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18060393 |
| Molecular Formula | C32H47N3O5S |
| Molecular Weight | 585.81 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-hydroxy-3-methylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1C)c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C32H47N3O5S/c1-8-9-10-11-12-18-35(30(38)25(20-41)33-31(39)40-32(5,6)7)28(24-16-17-26(36)23(4)19-24)29(37)34-27-21(2)14-13-15-22(27)3/h13-17,19,25,28,36,41H,8-12,18,20H2,1-7H3,(H,33,39)(H,34,37) |
| InChIKey | NXKCBATXINKDJZ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.81 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|