C33H48ClN3O4S — CID 18060647
tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18060647) has the molecular formula C33H48ClN3O4S and a molecular weight of 618.28 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18060647 |
| Molecular Formula | C33H48ClN3O4S |
| Molecular Weight | 618.28 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1Cl)c1c(C)cccc1C |
| InChI | InChI=1S/C33H48ClN3O4S/c1-8-9-10-11-12-13-20-37(31(39)26(21-42)35-32(40)41-33(5,6)7)29(27-22(2)16-14-17-23(27)3)30(38)36-28-24(4)18-15-19-25(28)34/h14-19,26,29,42H,8-13,20-21H2,1-7H3,(H,35,40)(H,36,38) |
| InChIKey | MUOUIGHKASWUFO-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.28 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|