C26H38N4O5 — CID 18061509
tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18061509) has the molecular formula C26H38N4O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18061509 |
| Molecular Formula | C26H38N4O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[2-(tert-butylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NC(C)(C)C)c1cc(C)ccc1C |
| InChI | InChI=1S/C26H38N4O5/c1-10-30(23(33)19(13-14-20(27)31)28-24(34)35-26(7,8)9)21(22(32)29-25(4,5)6)18-15-16(2)11-12-17(18)3/h1,11-12,15,19,21H,13-14H2,2-9H3,(H2,27,31)(H,28,34)(H,29,32) |
| InChIKey | KCKFVNAFJFHEIQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|