C28H46N4O6 — CID 18064287
tert-butyl N-[5-amino-1-[butyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18064287) has the molecular formula C28H46N4O6 and a molecular weight of 534.70 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[butyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[butyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18064287 |
| Molecular Formula | C28H46N4O6 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | tert-butyl N-[5-amino-1-[butyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1cccc(C)c1O)N(CCCC)C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H46N4O6/c1-7-9-11-17-30-25(35)23(20-14-12-13-19(3)24(20)34)32(18-10-8-2)26(36)21(15-16-22(29)33)31-27(37)38-28(4,5)6/h12-14,21,23,34H,7-11,15-18H2,1-6H3,(H2,29,33)(H,30,35)(H,31,37) |
| InChIKey | KEOQQIUQIWGMMU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|