C31H50N4O5 — CID 18065278
tert-butyl N-[5-amino-1-[[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-hexylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18065278) has the molecular formula C31H50N4O5 and a molecular weight of 558.76 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-hexylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-hexylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18065278 |
| Molecular Formula | C31H50N4O5 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-hexylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1ccccc1C |
| InChI | InChI=1S/C31H50N4O5/c1-6-7-8-14-21-35(29(38)25(19-20-26(32)36)34-30(39)40-31(3,4)5)27(24-18-13-12-15-22(24)2)28(37)33-23-16-10-9-11-17-23/h12-13,15,18,23,25,27H,6-11,14,16-17,19-21H2,1-5H3,(H2,32,36)(H,33,37)(H,34,39) |
| InChIKey | VVCDWASNSRNDLS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|