C29H37N3O6 — CID 18067047
tert-butyl N-[1-[ethynyl-[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18067047) has the molecular formula C29H37N3O6 and a molecular weight of 523.63 g/mol. Its IUPAC name is tert-butyl N-[1-[ethynyl-[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[ethynyl-[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18067047 |
| Molecular Formula | C29H37N3O6 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | tert-butyl N-[1-[ethynyl-[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1ccc(O)cc1 |
| InChI | InChI=1S/C29H37N3O6/c1-6-8-9-18-30-26(35)25(21-12-16-23(34)17-13-21)32(7-2)27(36)24(31-28(37)38-29(3,4)5)19-20-10-14-22(33)15-11-20/h2,10-17,24-25,33-34H,6,8-9,18-19H2,1,3-5H3,(H,30,35)(H,31,37) |
| InChIKey | KNKJFIVVUDHORA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|